(5E)-5-(ethoxy-hydroxy-methylidene)-9-methyl-2-(4-methylphenyl)sulfonyl-8-phenyl-10-thia-2-azabicyclo[5.3.0]deca-8,11-dien-6-one structure
|
Common Name | (5E)-5-(ethoxy-hydroxy-methylidene)-9-methyl-2-(4-methylphenyl)sulfonyl-8-phenyl-10-thia-2-azabicyclo[5.3.0]deca-8,11-dien-6-one | ||
|---|---|---|---|---|
| CAS Number | 54805-51-5 | Molecular Weight | 483.60000 | |
| Density | 1.336g/cm3 | Boiling Point | 658.9ºC at 760 mmHg | |
| Molecular Formula | C25H25NO5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 352.3ºC | |
| Name | ethyl 4-hydroxy-2-methyl-8-(4-methylphenyl)sulfonyl-3-phenyl-6,7-dihydrothieno[2,3-b]azepine-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.336g/cm3 |
|---|---|
| Boiling Point | 658.9ºC at 760 mmHg |
| Molecular Formula | C25H25NO5S2 |
| Molecular Weight | 483.60000 |
| Flash Point | 352.3ºC |
| Exact Mass | 483.11700 |
| PSA | 120.53000 |
| LogP | 6.60890 |
| Index of Refraction | 1.634 |
| InChIKey | GMGDELRQOPOUIJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(O)c2c(sc(C)c2-c2ccccc2)N(S(=O)(=O)c2ccc(C)cc2)CC1 |
|
~%
(5E)-5-(ethoxy-... CAS#:54805-51-5 |
| Literature: Koebel,R.F. et al. Journal of Medicinal Chemistry, 1975 , vol. 18, # 2 p. 192 - 194 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 5-Carbethoxy-2-methyl-3-phenyl-N-tosylthieno<2,3-b>azepin-4-on |
| 2-methyl-4-oxo-3-phenyl-8-(toluene-4-sulfonyl)-5,6,7,8-tetrahydro-4H-thieno[2,3-b]azepine-5-carboxylic acid ethyl ester |
| Ethyl 4-hydroxy-2-methyl-8-((4-methylphenyl)sulfonyl)-3-phenyl-7,8-dihydro-6H-thieno[2,3-b]azepine-5-carboxylate |