5,8-Dihydroxyflavone
Modify Date: 2025-12-02 14:09:26
5,8-Dihydroxyflavone structure
|
Common Name | 5,8-Dihydroxyflavone | ||
|---|---|---|---|---|
| CAS Number | 548-58-3 | Molecular Weight | 254.23700 | |
| Density | 1.443g/cm3 | Boiling Point | 497.4ºC at 760mmHg | |
| Molecular Formula | C15H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.8ºC | |
| Name | primetin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.443g/cm3 |
|---|---|
| Boiling Point | 497.4ºC at 760mmHg |
| Molecular Formula | C15H10O4 |
| Molecular Weight | 254.23700 |
| Flash Point | 194.8ºC |
| Exact Mass | 254.05800 |
| PSA | 70.67000 |
| LogP | 2.87120 |
| Index of Refraction | 1.698 |
| InChIKey | KYLWJAUHHPTDDH-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccccc2)oc2c(O)ccc(O)c12 |
| HS Code | 2914400090 |
|---|
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| FLAVONE,5,8-DIHYDROXY |
| 5,8-dihydroxy-2-phenylchromen-4-one |
| 5,8-Dihydroxy-2-phenyl-4H-1-benzopyran-4-one |
| Primetin |
| 5,8-dihydroxy-2-phenyl-chromen-4-one |
| 5,8-Dihydroxy-2-phenyl-chromen-4-on |
| 5,8-dihydroxyflavone |
| 5,8-Dihydroxyflavon |