4-methyl-N-(octan-2-ylideneamino)benzenesulfonamide structure
|
Common Name | 4-methyl-N-(octan-2-ylideneamino)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 54798-76-4 | Molecular Weight | 296.42800 | |
| Density | 1.08g/cm3 | Boiling Point | 417ºC at 760 mmHg | |
| Molecular Formula | C15H24N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206ºC | |
| Name | 2-octadecyloxymethyl-4-penten-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 417ºC at 760 mmHg |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.42800 |
| Flash Point | 206ºC |
| Exact Mass | 296.15600 |
| PSA | 66.91000 |
| LogP | 5.09130 |
| Index of Refraction | 1.531 |
| InChIKey | NWQGATUHYBIRBS-JQIJEIRASA-N |
| SMILES | CCCCCCC(C)=NNS(=O)(=O)c1ccc(C)cc1 |
|
~%
4-methyl-N-(oct... CAS#:54798-76-4 |
| Literature: Kabalka, George W.; Summers, Timothy S. Journal of Organic Chemistry, 1981 , vol. 46, p. 1217 - 1218 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| 2-octanone tosylhydrazone |