1,3,4-trimethyl-1-phenyl-2,5-dihydrosilole
Modify Date: 2025-08-25 06:44:08
1,3,4-trimethyl-1-phenyl-2,5-dihydrosilole structure
|
Common Name | 1,3,4-trimethyl-1-phenyl-2,5-dihydrosilole | ||
|---|---|---|---|---|
| CAS Number | 54797-05-6 | Molecular Weight | 202.36800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3,4-trimethyl-1-phenyl-2,5-dihydrosilole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H18Si |
|---|---|
| Molecular Weight | 202.36800 |
| Exact Mass | 202.11800 |
| LogP | 3.32220 |
| InChIKey | OWCZXLLXIGBHOM-UHFFFAOYSA-N |
| SMILES | CC1=C(C)C[Si](C)(c2ccccc2)C1 |
|
~9%
1,3,4-trimethyl... CAS#:54797-05-6 |
| Literature: Kunai, Atsutaka; Ueda, Takafumi; Toyoda, Eiji; Ishikawa, Mitsuo Bulletin of the Chemical Society of Japan, 1994 , vol. 67, # 1 p. 287 - 289 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Silacyclopent-3-ene,1,3,4-trimethyl-1-phenyl |
| 1,3,4-trimethyl-1-phenyl-1-silacyclopentene |
| 1,3,4-trimethyl-1-phenyl-2,5-dihydro-1H-silole |
| 1-methyl-1-phenyl-3,4-dimethyl-1-silacyclopent-3-ene |
| 1,3,4-trimethyl-1-fenylsilacyclopent-3-ene |
| 1,3,4-Trimethyl-1-phenyl-1-silacyclo-3-penten |