2,4-Dichlorophenylalanine
2,4-Dichlorophenylalanine structure
|
Common Name | 2,4-Dichlorophenylalanine | ||
|---|---|---|---|---|
| CAS Number | 5472-68-4 | Molecular Weight | 234.079 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 368.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H9Cl2NO2 | Melting Point | 239ºC | |
| MSDS | N/A | Flash Point | 176.4±27.9 °C | |
| Name | 2-amino-3-(2,4-dichlorophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 368.1±42.0 °C at 760 mmHg |
| Melting Point | 239ºC |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.079 |
| Flash Point | 176.4±27.9 °C |
| Exact Mass | 233.001038 |
| PSA | 63.32000 |
| LogP | 2.32 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | GWHQTNKPTXDNRM-UHFFFAOYSA-N |
| SMILES | NC(Cc1ccc(Cl)cc1Cl)C(=O)O |
| HS Code | 2922499990 |
|---|
|
~%
2,4-Dichlorophe... CAS#:5472-68-4 |
| Literature: Journal of the American Chemical Society, , vol. 73, p. 3502 |
|
~%
2,4-Dichlorophe... CAS#:5472-68-4 |
| Literature: Journal of the American Chemical Society, , vol. 73, p. 3502 |
|
~%
2,4-Dichlorophe... CAS#:5472-68-4 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 7, p. 912,914, 916 |
|
~%
2,4-Dichlorophe... CAS#:5472-68-4 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 7, p. 912,914, 916 |
|
~%
2,4-Dichlorophe... CAS#:5472-68-4 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 7, p. 912,914, 916 |
![Propanedioic acid, 2-(acetylamino)-2-[(2,4-dichlorophenyl)methyl]-,1,3-diethyl ester structure](https://image.chemsrc.com/caspic/073/5472-72-0.png)
![diethyl 2-[(2,4-dichlorophenyl)methyl]propanedioate structure](https://image.chemsrc.com/caspic/094/61023-54-9.png)
CAS#:114872-98-9
CAS#:111119-36-9| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2,4-dichloro-phenylalanine |
| 2,4-Dichlor-L-phenylalanin |
| Phenylalanine, 2,4-dichloro- |
| (2S)-2-amino-3-(2,4-dichlorophenyl)propanoic acid |
| DL-3-(2,4-Dichlorophenyl)alanine |
| D,L 2,4-dichlorophenylalanine |
| 2,4-Dichlor-phenylalanin |
| 2,4-diCl-Phe |
| 2,4-Dichloro-DL-phenylalanine |
| L-phenylalanine, 2,4-dichloro- |
| rac-2,4-dichloro-Phe |
| 2,4-Dichloro-L-phenylalanine |
| 2,4-Dichlorophenylalanine |
| 4-Dichloro-DL-phenylalanine |
| BOC-D-2 |
| BOC-2 |