1,2,4-Triazin-3(2H)-one,5,6-bis(4-methoxyphenyl)- structure
|
Common Name | 1,2,4-Triazin-3(2H)-one,5,6-bis(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5471-46-5 | Molecular Weight | 309.31900 | |
| Density | 1.27g/cm3 | Boiling Point | 532ºC at 760 mmHg | |
| Molecular Formula | C17H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.5ºC | |
| Name | 5,6-bis(4-methoxyphenyl)-2H-1,2,4-triazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 532ºC at 760 mmHg |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.31900 |
| Flash Point | 275.5ºC |
| Exact Mass | 309.11100 |
| PSA | 77.10000 |
| LogP | 2.51610 |
| Index of Refraction | 1.621 |
| InChIKey | NDTQIXGIWFMLRG-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2n[nH]c(=O)nc2-c2ccc(OC)cc2)cc1 |
| Storage condition | 2-8°C |
| HS Code | 2933699090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 3-Hydroxy-5,6-di-p-methoxyphenyl-1,2,4-triazin |