Benzeneethanamine,a-(3,4-dimethoxyphenyl)-3,4-dimethoxy- structure
|
Common Name | Benzeneethanamine,a-(3,4-dimethoxyphenyl)-3,4-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 5471-40-9 | Molecular Weight | 317.38000 | |
| Density | 1.119g/cm3 | Boiling Point | 431.9ºC at 760mmHg | |
| Molecular Formula | C18H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.3ºC | |
| Name | 1,2-bis(3,4-dimethoxyphenyl)ethan-1-amine |
|---|
| Density | 1.119g/cm3 |
|---|---|
| Boiling Point | 431.9ºC at 760mmHg |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38000 |
| Flash Point | 217.3ºC |
| Exact Mass | 317.16300 |
| PSA | 62.94000 |
| LogP | 3.66380 |
| Index of Refraction | 1.639 |
| InChIKey | FOCRDATZPOZOFJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(N)c2ccc(OC)c(OC)c2)cc1OC |
| HS Code | 2922299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |