1-Naphthalenemethanol, a-[2-(diethylamino)-1,1-dimethylethyl]-4-methoxy- structure
|
Common Name | 1-Naphthalenemethanol, a-[2-(diethylamino)-1,1-dimethylethyl]-4-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 5471-17-0 | Molecular Weight | 315.45000 | |
| Density | 1.046g/cm3 | Boiling Point | 457ºC at 760mmHg | |
| Molecular Formula | C20H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.2ºC | |
| Name | 3-(diethylamino)-1-(4-methoxynaphthalen-1-yl)-2,2-dimethylpropan-1-ol |
|---|
| Density | 1.046g/cm3 |
|---|---|
| Boiling Point | 457ºC at 760mmHg |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.45000 |
| Flash Point | 230.2ºC |
| Exact Mass | 315.22000 |
| PSA | 32.70000 |
| LogP | 4.24980 |
| InChIKey | CFLLSOPLOOHFGY-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(C)(C)C(O)c1ccc(OC)c2ccccc12 |
| HS Code | 2922509090 |
|---|
|
~%
1-Naphthaleneme... CAS#:5471-17-0 |
| Literature: Jacobs et al. Journal of Organic Chemistry, 1946 , vol. 11, p. 223,227 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |