4,4'-Methylenebis[N-(1,3-dimethylbutylidene)benzenamine] structure
|
Common Name | 4,4'-Methylenebis[N-(1,3-dimethylbutylidene)benzenamine] | ||
|---|---|---|---|---|
| CAS Number | 54688-30-1 | Molecular Weight | 362.55100 | |
| Density | 0.94g/cm3 | Boiling Point | 467ºC at 760 mmHg | |
| Molecular Formula | C25H34N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.1ºC | |
| Name | 4-methyl-N-[4-[[4-(4-methylpentan-2-ylideneamino)phenyl]methyl]phenyl]pentan-2-imine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.94g/cm3 |
|---|---|
| Boiling Point | 467ºC at 760 mmHg |
| Molecular Formula | C25H34N2 |
| Molecular Weight | 362.55100 |
| Flash Point | 229.1ºC |
| Exact Mass | 362.27200 |
| PSA | 24.72000 |
| LogP | 7.55440 |
| Index of Refraction | 1.528 |
| InChIKey | JIOIBTYPZZUMPL-UHFFFAOYSA-N |
| SMILES | CC(CC(C)C)=Nc1ccc(Cc2ccc(N=C(C)CC(C)C)cc2)cc1 |
| 4,4'-methanediylbis{N-[(2E)-4-methylpentan-2-ylidene]aniline} |
| Methylene dianiline and methyl isobutyl ketone ketimine |
| Benzenamine,4,4'-methylenebis(N-(1,3-dimethylbutylidene) |