[4-[(2-chlorophenyl)methyl]-2-methyl-phenyl] 4-chlorobenzoate structure
|
Common Name | [4-[(2-chlorophenyl)methyl]-2-methyl-phenyl] 4-chlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 5468-41-7 | Molecular Weight | 371.25700 | |
| Density | 1.269g/cm3 | Boiling Point | 529.9ºC at 760 mmHg | |
| Molecular Formula | C21H16Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197ºC | |
| Name | [4-[(2-chlorophenyl)methyl]-2-methylphenyl] 4-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 529.9ºC at 760 mmHg |
| Molecular Formula | C21H16Cl2O2 |
| Molecular Weight | 371.25700 |
| Flash Point | 197ºC |
| Exact Mass | 370.05300 |
| PSA | 26.30000 |
| LogP | 6.11180 |
| Index of Refraction | 1.613 |
| InChIKey | ZVKQGCBKOWTAMZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cc2ccccc2Cl)ccc1OC(=O)c1ccc(Cl)cc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-(4-chloro-benzoyloxy)-4-(2-chloro-benzyl)-2-methyl-benzene |
| 1-(4-Chlor-benzoyloxy)-4-(2-chlor-benzyl)-2-methyl-benzol |
| 4-(2-chlorobenzyl)-2-methylphenyl 4-chlorobenzoate |