Benzoic acid,4-methoxy-, 3-ethoxy-3-oxo-1-phenyl-1-propen-1-yl ester structure
|
Common Name | Benzoic acid,4-methoxy-, 3-ethoxy-3-oxo-1-phenyl-1-propen-1-yl ester | ||
|---|---|---|---|---|
| CAS Number | 5467-88-9 | Molecular Weight | 326.34300 | |
| Density | 1.18g/cm3 | Boiling Point | 479.1ºC at 760mmHg | |
| Molecular Formula | C19H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211ºC | |
| Name | [(E)-3-ethoxy-3-oxo-1-phenylprop-1-enyl] 4-methoxybenzoate |
|---|
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 479.1ºC at 760mmHg |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.34300 |
| Flash Point | 211ºC |
| Exact Mass | 326.11500 |
| PSA | 61.83000 |
| LogP | 3.45620 |
| Index of Refraction | 1.563 |
| InChIKey | DGTBPTOAHLUKHZ-GHRIWEEISA-N |
| SMILES | CCOC(=O)C=C(OC(=O)c1ccc(OC)cc1)c1ccccc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |