6-amino-5-nitroso-2-phenyl-1H-pyrimidin-4-one structure
|
Common Name | 6-amino-5-nitroso-2-phenyl-1H-pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 5466-66-0 | Molecular Weight | 216.19600 | |
| Density | 1.52g/cm3 | Boiling Point | 328.4ºC at 760 mmHg | |
| Molecular Formula | C10H8N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.4ºC | |
| Name | 6-amino-5-nitroso-2-phenyl-1H-pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 328.4ºC at 760 mmHg |
| Molecular Formula | C10H8N4O2 |
| Molecular Weight | 216.19600 |
| Flash Point | 152.4ºC |
| Exact Mass | 216.06500 |
| PSA | 101.20000 |
| LogP | 1.99820 |
| Index of Refraction | 1.723 |
| InChIKey | DFOUWTNXVWFGGD-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccccc2)[nH]c(=O)c1N=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-amino-5-nitroso-2-phenyl-3H-pyrimidin-4-one |
| 5-Nitroso-6-amino-4-hydroxy-2-phenyl-pyrimidin |
| HMS2885J16 |
| 4-Amino-5-nitroso-6-hydroxy-2-phenyl-pyrimidin |