sodium [S-(R*,R*)]-2-hydroxy-3-methylvalerate structure
|
Common Name | sodium [S-(R*,R*)]-2-hydroxy-3-methylvalerate | ||
|---|---|---|---|---|
| CAS Number | 54641-22-4 | Molecular Weight | 154.14000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H11NaO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,(2S,3S)-2-hydroxy-3-methylpentanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H11NaO3 |
|---|---|
| Molecular Weight | 154.14000 |
| Exact Mass | 154.06100 |
| PSA | 60.36000 |
| InChIKey | GVCWJRGDIHEKAT-FHAQVOQBSA-M |
| SMILES | CCC(C)C(O)C(=O)[O-].[Na+] |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| einecs 259-271-0 |