Phenol,2,4,6-tris(4-morpholinylmethyl)- structure
|
Common Name | Phenol,2,4,6-tris(4-morpholinylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 5464-87-9 | Molecular Weight | 391.50400 | |
| Density | 1.222g/cm3 | Boiling Point | 518.4ºC at 760mmHg | |
| Molecular Formula | C21H33N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.3ºC | |
| Name | 2,4,6-tris(morpholin-4-ylmethyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 518.4ºC at 760mmHg |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.50400 |
| Flash Point | 267.3ºC |
| Exact Mass | 391.24700 |
| PSA | 57.64000 |
| LogP | 0.70250 |
| Index of Refraction | 1.587 |
| InChIKey | JGTWRXHFXRFYTN-UHFFFAOYSA-N |
| SMILES | Oc1c(CN2CCOCC2)cc(CN2CCOCC2)cc1CN1CCOCC1 |
|
~%
Phenol,2,4,6-tr... CAS#:5464-87-9 |
| Literature: Bruson; MacMullen Journal of the American Chemical Society, 1941 , vol. 63, p. 270 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,4,6-tris-morpholin-4-ylmethyl-phenol |
| 2,4,6-Tris-morpholinomethyl-phenol |