2-[bis(2-cyanoethyl)amino]-3-[4-(2-cyanoethoxy)phenyl]propanoic acid
Modify Date: 2025-09-18 21:58:35
![2-[bis(2-cyanoethyl)amino]-3-[4-(2-cyanoethoxy)phenyl]propanoic acid Structure](https://image.chemsrc.com/caspic/454/5464-51-7.png)
2-[bis(2-cyanoethyl)amino]-3-[4-(2-cyanoethoxy)phenyl]propanoic acid structure
|
Common Name | 2-[bis(2-cyanoethyl)amino]-3-[4-(2-cyanoethoxy)phenyl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 5464-51-7 | Molecular Weight | 340.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[bis(2-cyanoethyl)amino]-3-[4-(2-cyanoethoxy)phenyl]propanoic acid |
|---|
| Molecular Formula | C18H20N4O3 |
|---|---|
| Molecular Weight | 340.37600 |
| Exact Mass | 340.15400 |
| PSA | 121.14000 |
| LogP | 2.10414 |
| InChIKey | HQBDTGHRTWMWRY-UHFFFAOYSA-N |
| SMILES | N#CCCOc1ccc(CC(C(=O)O)N(CCC#N)CCC#N)cc1 |
|
~%
2-[bis(2-cyanoe... CAS#:5464-51-7 |
| Literature: McKinney et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 1641,1643 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |