ethyl 2-(2-ethoxycarbonylethylamino)-3-phenyl-propanoate
Modify Date: 2024-03-03 17:38:54
ethyl 2-(2-ethoxycarbonylethylamino)-3-phenyl-propanoate structure
|
Common Name | ethyl 2-(2-ethoxycarbonylethylamino)-3-phenyl-propanoate | ||
|---|---|---|---|---|
| CAS Number | 5464-50-6 | Molecular Weight | 329.81900 | |
| Density | 1.084g/cm3 | Boiling Point | 398.7ºC at 760 mmHg | |
| Molecular Formula | C16H24ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.9ºC | |
| Name | ethyl 2-[(3-ethoxy-3-oxopropyl)amino]-3-phenylpropanoate |
|---|
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 398.7ºC at 760 mmHg |
| Molecular Formula | C16H24ClNO4 |
| Molecular Weight | 329.81900 |
| Flash Point | 194.9ºC |
| Exact Mass | 329.13900 |
| PSA | 64.63000 |
| LogP | 2.89650 |
| Index of Refraction | 1.503 |
| InChIKey | DTDRSXIMMYULKA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCNC(Cc1ccccc1)C(=O)OCC.Cl |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |