2,4-Dinitrophenylmethacrylate
Modify Date: 2025-09-25 19:15:22
2,4-Dinitrophenylmethacrylate structure
|
Common Name | 2,4-Dinitrophenylmethacrylate | ||
|---|---|---|---|---|
| CAS Number | 54616-59-0 | Molecular Weight | 252.18000 | |
| Density | 1.411g/cm3 | Boiling Point | 408.6ºC at 760 mmHg | |
| Molecular Formula | C10H8N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.5ºC | |
| Name | (2,4-dinitrophenyl) 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.411g/cm3 |
|---|---|
| Boiling Point | 408.6ºC at 760 mmHg |
| Molecular Formula | C10H8N2O6 |
| Molecular Weight | 252.18000 |
| Flash Point | 192.5ºC |
| Exact Mass | 252.03800 |
| PSA | 117.94000 |
| LogP | 3.03090 |
| Index of Refraction | 1.58 |
| InChIKey | JOZILYOMCYIYFH-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2916140000 |
|---|
|
~%
2,4-Dinitrophen... CAS#:54616-59-0 |
| Literature: Lebedew; Andrianowa Zhurnal Obshchei Khimii, 1955 , vol. 25, p. 210,211, 212; engl. Ausg. S. 193 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916140000 |
|---|---|
| Summary | 2916140000. other esters of methacrylic acid. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:80.0% |
| 2,4-Dinitrophenylmethacrylate |
| 2-Propenoic acid,2-methyl-,2,4-dinitrophenyl ester |
| methacrylic acid-(2,4-dinitro-phenyl ester) |
| 2,4-dinitrophenyl 2-methylprop-2-enoate |
| Methacrylsaeure-(2,4-dinitro-phenylester) |