1,3-Benzodioxole,5-(2-bromo-1-methoxypropyl)- structure
|
Common Name | 1,3-Benzodioxole,5-(2-bromo-1-methoxypropyl)- | ||
|---|---|---|---|---|
| CAS Number | 5457-88-5 | Molecular Weight | 273.12300 | |
| Density | 1.459g/cm3 | Boiling Point | 310.5ºC at 760mmHg | |
| Molecular Formula | C11H13BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.1ºC | |
| Name | 5-(2-bromo-1-methoxypropyl)-1,3-benzodioxole |
|---|
| Density | 1.459g/cm3 |
|---|---|
| Boiling Point | 310.5ºC at 760mmHg |
| Molecular Formula | C11H13BrO3 |
| Molecular Weight | 273.12300 |
| Flash Point | 125.1ºC |
| Exact Mass | 272.00500 |
| PSA | 27.69000 |
| LogP | 2.88620 |
| Index of Refraction | 1.561 |
| InChIKey | JQJJDOUHCWKQHF-UHFFFAOYSA-N |
| SMILES | COC(c1ccc2c(c1)OCO2)C(C)Br |
| HS Code | 2932999099 |
|---|
|
~%
1,3-Benzodioxol... CAS#:5457-88-5 |
| Literature: Schmidt; Bartholome; Luebke Chemische Berichte, 1922 , vol. 55, p. 2103 |
|
~%
1,3-Benzodioxol... CAS#:5457-88-5 |
| Literature: Hoering Chemische Berichte, 1905 , vol. 38, p. 3469 Chem. Zentralbl., 1906 , vol. 77, # II p. 1223 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |