ethyl (4E)-4-[(4-nitrophenyl)hydrazinylidene]pentanoate structure
|
Common Name | ethyl (4E)-4-[(4-nitrophenyl)hydrazinylidene]pentanoate | ||
|---|---|---|---|---|
| CAS Number | 5457-85-2 | Molecular Weight | 279.29200 | |
| Density | 1.21g/cm3 | Boiling Point | 419.6ºC at 760 mmHg | |
| Molecular Formula | C13H17N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.5ºC | |
| Name | ethyl 4-[(4-nitrophenyl)hydrazinylidene]pentanoate |
|---|
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 419.6ºC at 760 mmHg |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.29200 |
| Flash Point | 207.5ºC |
| Exact Mass | 279.12200 |
| PSA | 96.51000 |
| LogP | 3.32210 |
| Index of Refraction | 1.551 |
| InChIKey | SNAQEOYVKJDXKG-UVTDQMKNSA-N |
| SMILES | CCOC(=O)CCC(C)=NNc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2928000090 |
|---|
|
~%
ethyl (4E)-4-[(... CAS#:5457-85-2 |
| Literature: Fischer,E.; Ach Justus Liebigs Annalen der Chemie, 1889 , vol. 253, p. 59 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |