ethyl 1-phenacyl-4-phenyl-piperidine-4-carboxylate
Modify Date: 2025-08-25 15:11:03
ethyl 1-phenacyl-4-phenyl-piperidine-4-carboxylate structure
|
Common Name | ethyl 1-phenacyl-4-phenyl-piperidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5457-61-4 | Molecular Weight | 351.43900 | |
| Density | 1.129g/cm3 | Boiling Point | 481ºC at 760 mmHg | |
| Molecular Formula | C22H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.7ºC | |
| Name | ethyl 1-phenacyl-4-phenylpiperidine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 481ºC at 760 mmHg |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.43900 |
| Flash Point | 244.7ºC |
| Exact Mass | 351.18300 |
| PSA | 46.61000 |
| LogP | 3.40410 |
| Index of Refraction | 1.561 |
| InChIKey | XFKPHSMWBQJLCT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(CC(=O)c2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2-oxo-2-phenyl-ethyl)-4-phenyl-piperidine-4-carboxylic acid ethyl ester |
| 1-Phenacyl-4-phenyl-piperidin-carbonsaeure-(4)-ethylester |
| 1-Phenacyl-4-phenyl-4-ethoxycarbonyl-piperidin |
| Ethyl 1-(2-oxo-2-phenylethyl)-4-phenyl-4-piperidinecarboxylate |