2,4-dimethyl-N,N-bis(2-methylpropyl)pentan-3-amine
Modify Date: 2025-08-26 22:00:17
2,4-dimethyl-N,N-bis(2-methylpropyl)pentan-3-amine structure
|
Common Name | 2,4-dimethyl-N,N-bis(2-methylpropyl)pentan-3-amine | ||
|---|---|---|---|---|
| CAS Number | 54561-97-6 | Molecular Weight | 227.42900 | |
| Density | 0.797g/cm3 | Boiling Point | 225.8ºC at 760 mmHg | |
| Molecular Formula | C15H33N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 76.9ºC | |
| Name | 2,4-dimethyl-N,N-bis(2-methylpropyl)pentan-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.797g/cm3 |
|---|---|
| Boiling Point | 225.8ºC at 760 mmHg |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.42900 |
| Flash Point | 76.9ºC |
| Exact Mass | 227.26100 |
| PSA | 3.24000 |
| LogP | 4.28100 |
| Index of Refraction | 1.439 |
| InChIKey | PGAQYUJUOZNEOE-UHFFFAOYSA-N |
| SMILES | CC(C)CN(CC(C)C)C(C(C)C)C(C)C |
| RIDADR | UN 2735 |
|---|---|
| Packaging Group | II |
| HS Code | 2921199090 |
|
~%
2,4-dimethyl-N,... CAS#:54561-97-6 |
| Literature: Mengler,C.-D. Justus Liebigs Annalen der Chemie, 1974 , p. 1545 - 1549 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921199090 |
|---|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N,N-DIISOBUTYL-2,4-DIMETHYL-3-PENTYLAMINE |
| (diisopropylmethyl)diisobutylamine |
| 3-(diisobutylamino)-2,4-dimethylpentane |
| EINECS 259-230-7 |
| 3-(N,N-diisobutylamino)-2,4-dimethylpentane |
| N-(1-isopropyl-2-methylpropyl)diisobutylamine |
| 3-Pentanamine,2,4-dimethyl-N,N-bis(2-methylpropyl) |
| N,N-Diisobutyl(diisopropylmethyl)amine |
| diisobutyl-(2,4-dimethylpentane-3-yl)amine |