Benzenecarboximidamide,N,N-dibutyl-3,4-dimethoxy-, hydrochloride (1:1) structure
|
Common Name | Benzenecarboximidamide,N,N-dibutyl-3,4-dimethoxy-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 5456-54-2 | Molecular Weight | 292.41600 | |
| Density | 0.99g/cm3 | Boiling Point | 377.7ºC at 760mmHg | |
| Molecular Formula | C17H28N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.2ºC | |
| Name | N,N-dibutyl-3,4-dimethoxybenzenecarboximidamide |
|---|
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 377.7ºC at 760mmHg |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.41600 |
| Flash Point | 182.2ºC |
| Exact Mass | 292.21500 |
| PSA | 45.55000 |
| LogP | 4.03110 |
| Index of Refraction | 1.496 |
| InChIKey | UYQJPPYFYFODDR-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)C(=N)c1ccc(OC)c(OC)c1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |