Phenol,2,6-bis(1,1-dimethylethyl)-4-(1-methoxyethyl)-
Modify Date: 2025-09-18 13:25:47
Phenol,2,6-bis(1,1-dimethylethyl)-4-(1-methoxyethyl)- structure
|
Common Name | Phenol,2,6-bis(1,1-dimethylethyl)-4-(1-methoxyethyl)- | ||
|---|---|---|---|---|
| CAS Number | 5456-18-8 | Molecular Weight | 264.40300 | |
| Density | 0.952g/cm3 | Boiling Point | 285.9ºC at 760mmHg | |
| Molecular Formula | C17H28O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 85.7ºC | |
| Name | 2,6-ditert-butyl-4-(1-methoxyethyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.952g/cm3 |
|---|---|
| Boiling Point | 285.9ºC at 760mmHg |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.40300 |
| Flash Point | 85.7ºC |
| Exact Mass | 264.20900 |
| PSA | 29.46000 |
| LogP | 4.69460 |
| Index of Refraction | 1.494 |
| InChIKey | YWUVHLCPQKQMRU-UHFFFAOYSA-N |
| SMILES | COC(C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| HS Code | 2909500000 |
|---|
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-(1-METHOXYETHYL)-2,6-DITERT-BUTYL-PHENOL |
| 2,6-di-tert-butyl-4-(1-methoxyethyl)phenol |
| 4-(1-Methoxy-aethyl)-2,6-di-tert.-butyl-phenol |