6-(2-phenoxyethylsulfanyl)-5H-purine structure
|
Common Name | 6-(2-phenoxyethylsulfanyl)-5H-purine | ||
|---|---|---|---|---|
| CAS Number | 5454-52-4 | Molecular Weight | 272.32600 | |
| Density | 1.38g/cm3 | Boiling Point | 441.6ºC at 760 mmHg | |
| Molecular Formula | C13H12N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.9ºC | |
| Name | 6-(2-phenoxyethylsulfanyl)-7H-purine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 441.6ºC at 760 mmHg |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.32600 |
| Flash Point | 220.9ºC |
| Exact Mass | 272.07300 |
| PSA | 88.99000 |
| LogP | 2.52400 |
| Index of Refraction | 1.704 |
| InChIKey | LISMPHSRTXYGFG-UHFFFAOYSA-N |
| SMILES | c1ccc(OCCSc2ncnc3nc[nH]c23)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms2469p17 |