Benzoic acid,4-(9H-fluoren-9-ylideneamino)- structure
|
Common Name | Benzoic acid,4-(9H-fluoren-9-ylideneamino)- | ||
|---|---|---|---|---|
| CAS Number | 5454-40-0 | Molecular Weight | 299.32300 | |
| Density | 1.24g/cm3 | Boiling Point | 512.9ºC at 760 mmHg | |
| Molecular Formula | C20H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264ºC | |
| Name | 4-(fluoren-9-ylideneamino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 512.9ºC at 760 mmHg |
| Molecular Formula | C20H13NO2 |
| Molecular Weight | 299.32300 |
| Flash Point | 264ºC |
| Exact Mass | 299.09500 |
| PSA | 49.66000 |
| LogP | 4.53430 |
| Index of Refraction | 1.667 |
| InChIKey | FSHGEJNHETXXNN-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(N=C2c3ccccc3-c3ccccc32)cc1 |
| HS Code | 2925290090 |
|---|
|
~%
Benzoic acid,4-... CAS#:5454-40-0 |
| Literature: Reddelien Chemische Berichte, 1921 , vol. 54, p. 3130 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| HMS3093I18 |
| 4-fluoren-9-ylidenamino-benzoic acid |
| 4-Fluoren-9-ylidenamino-benzoesaeure |