7-(3-bromopropoxy)-4-methylchromen-2-one
Modify Date: 2025-09-21 13:29:01
7-(3-bromopropoxy)-4-methylchromen-2-one structure
|
Common Name | 7-(3-bromopropoxy)-4-methylchromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 54536-34-4 | Molecular Weight | 297.14500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-(3-bromopropoxy)-4-methylchromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13BrO3 |
|---|---|
| Molecular Weight | 297.14500 |
| Exact Mass | 296.00500 |
| PSA | 39.44000 |
| LogP | 3.26520 |
| InChIKey | BCLYFAOVZXQQTN-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)oc2cc(OCCCBr)ccc12 |
|
~90%
7-(3-bromopropo... CAS#:54536-34-4 |
| Literature: Xi, Hai-Tao; Xiong, Min-Qiu; Wang, Lei-Lei; Hu, Quan-Zi; Sun, Xiao-Qiang Journal of the Chinese Chemical Society, 2010 , vol. 57, # 4 A p. 612 - 615 |
|
~54%
7-(3-bromopropo... CAS#:54536-34-4 |
| Literature: Chen, Yin; Wang, Songlin; Xu, Xiangqing; Liu, Xin; Yu, Minquan; Zhao, Song; Liu, Shicheng; Qiu, Yinli; Zhang, Tan; Liu, Bi-Feng; Zhang, Guisen Journal of Medicinal Chemistry, 2013 , vol. 56, # 11 p. 4671 - 4690 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2H-1-Benzopyran-2-one,7-(3-bromopropoxy)-4-methyl |
| 1-(4'-Methylcoumarin-7'-oxy)-3-brompropan |
| 7-(3-bromopropoxy)-4-methylcoumarin |
| 7-(3-bromopropoxy)-4-methyl-2H-chromen-2-one |
| 7-(3-bromo-propoxy)-4-methyl-chromen-2-one |