(1,1-dioxo-2-phenyl-thiazinan-6-yl)-diphenyl-methanol structure
|
Common Name | (1,1-dioxo-2-phenyl-thiazinan-6-yl)-diphenyl-methanol | ||
|---|---|---|---|---|
| CAS Number | 54531-87-2 | Molecular Weight | 393.49900 | |
| Density | 1.277g/cm3 | Boiling Point | 580.1ºC at 760 mmHg | |
| Molecular Formula | C23H23NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.6ºC | |
| Name | (1,1-dioxo-2-phenylthiazinan-6-yl)-diphenylmethanol |
|---|
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 580.1ºC at 760 mmHg |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.49900 |
| Flash Point | 304.6ºC |
| Exact Mass | 393.14000 |
| PSA | 65.99000 |
| LogP | 5.06710 |
| Index of Refraction | 1.643 |
| InChIKey | QCDCWPKYHIJQLR-UHFFFAOYSA-N |
| SMILES | O=S1(=O)C(C(O)(c2ccccc2)c2ccccc2)CCCN1c1ccccc1 |
|
~%
(1,1-dioxo-2-ph... CAS#:54531-87-2 |
| Literature: Kaiser,E.M.; Knutson,P.L.A. Journal of Organic Chemistry, 1975 , vol. 40, p. 1342 - 1346 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |