6-benzyl-2-methyl-thiazinane 1,1-dioxide structure
|
Common Name | 6-benzyl-2-methyl-thiazinane 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 54531-82-7 | Molecular Weight | 239.33400 | |
| Density | 1.182g/cm3 | Boiling Point | 366.9ºC at 760 mmHg | |
| Molecular Formula | C12H17NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.7ºC | |
| Name | 6-benzyl-2-methylthiazinane 1,1-dioxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 366.9ºC at 760 mmHg |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.33400 |
| Flash Point | 175.7ºC |
| Exact Mass | 239.09800 |
| PSA | 45.76000 |
| LogP | 2.67180 |
| Index of Refraction | 1.557 |
| InChIKey | LJVSUFPCQJHVOQ-UHFFFAOYSA-N |
| SMILES | CN1CCCC(Cc2ccccc2)S1(=O)=O |
|
~%
6-benzyl-2-meth... CAS#:54531-82-7 |
| Literature: Kaiser,E.M.; Knutson,P.L.A. Journal of Organic Chemistry, 1975 , vol. 40, p. 1342 - 1346 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-benzyl-2-methyl-[1,2]thiazinane 1,1-dioxide |