1,1,1,2-tetrachloro-2-nitroethane structure
|
Common Name | 1,1,1,2-tetrachloro-2-nitroethane | ||
|---|---|---|---|---|
| CAS Number | 54529-52-1 | Molecular Weight | 212.84700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C2HCl4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,2-tetrachloro-2-nitroethane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C2HCl4NO2 |
|---|---|
| Molecular Weight | 212.84700 |
| Exact Mass | 210.87600 |
| PSA | 45.82000 |
| LogP | 2.72140 |
| InChIKey | MLCDVZNERFBEPA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C(Cl)C(Cl)(Cl)Cl |
|
~%
1,1,1,2-tetrach... CAS#:54529-52-1 |
| Literature: Haszeldine Journal of the Chemical Society, 1953 , p. 2075,2079 |
|
~%
1,1,1,2-tetrach... CAS#:54529-52-1 |
| Literature: Haszeldine Journal of the Chemical Society, 1953 , p. 2075,2079 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 1,1,1,2-Tetrachlor-2-nitro-aethan |
| 1,1,1,2-tetrachloro-2-nitro-ethane |
| 1,1,1,2-Tetrachlor-2-nitroethan |
| Ethane,1,1,1,2-tetrachloro-2-nitro |
| 1,2,2,2-tetrachloro-1-nitroethane |
| 1,2,2,2-Tetrachlor-1-nitro-aethan |