2-chloroethyl methyl 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate structure
|
Common Name | 2-chloroethyl methyl 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 54527-89-8 | Molecular Weight | 394.80600 | |
| Density | 1.315g/cm3 | Boiling Point | 530.8ºC at 760 mmHg | |
| Molecular Formula | C18H19ClN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.8ºC | |
| Name | 5-O-(2-chloroethyl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.315g/cm3 |
|---|---|
| Boiling Point | 530.8ºC at 760 mmHg |
| Molecular Formula | C18H19ClN2O6 |
| Molecular Weight | 394.80600 |
| Flash Point | 274.8ºC |
| Exact Mass | 394.09300 |
| PSA | 110.45000 |
| LogP | 3.63660 |
| Index of Refraction | 1.562 |
| InChIKey | HFLGCPOPFWAWDG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCCl)C1c1cccc([N+](=O)[O-])c1 |
|
~62%
2-chloroethyl m... CAS#:54527-89-8 |
| Literature: Leonardi, Amedeo; Motta, Gianni; Pennini, Renzo; Testa, Rodolfo; Sironi, Giorgio; Catto, Alberto; Cerri, Alberto; Zappa, Marco; Bianchi, Giorgio; Nardi, Dante European Journal of Medicinal Chemistry, 1998 , vol. 33, # 5 p. 399 - 420 |
|
~27%
2-chloroethyl m... CAS#:54527-89-8 |
| Literature: Meyer; Wehinger; Bossert; Scherling Arzneimittel-Forschung/Drug Research, 1983 , vol. 33, # 1 p. 106 - 112 |
| 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid methyl ester 2-chloroethyl ester |
| 2-chloroethyl 5-carbomethoxy-1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3-pyridinecarboxylate |
| 2-Chloroethyl methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| 2-Chloroethyl Methyl 1,4-Dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylate |
| 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid 3-(2-chloroethyl)ester-5-methyl ester |
| 2-chloroethyl methyl 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-pyridine-3,5-dicarboxylate |
| 3,5-Pyridinedicarboxylicacid,1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-,2-chloroethyl methyl ester(9CI) |