9-cyclohexyl-3H-purin-6-one structure
|
Common Name | 9-cyclohexyl-3H-purin-6-one | ||
|---|---|---|---|---|
| CAS Number | 5452-42-6 | Molecular Weight | 218.25500 | |
| Density | 1.49g/cm3 | Boiling Point | 485.3ºC at 760 mmHg | |
| Molecular Formula | C11H14N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.3ºC | |
| Name | 9-cyclohexyl-3H-purin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 485.3ºC at 760 mmHg |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.25500 |
| Flash Point | 247.3ºC |
| Exact Mass | 218.11700 |
| PSA | 63.57000 |
| LogP | 1.62480 |
| Index of Refraction | 1.748 |
| InChIKey | WCMXSKNLJUSQEK-UHFFFAOYSA-N |
| SMILES | O=c1[nH]cnc2c1ncn2C1CCCCC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-cyclohexyl-1,9-dihydro-purin-6-one |
| 9-cyclohexyl-3,9-dihydro-6h-purin-6-one |
| 9-Cyclohexylhypoxanthin |