Propanoic acid,2-methyl-, 4-(1,1-dimethylethyl)cyclohexyl ester
Modify Date: 2025-08-23 12:59:58
Propanoic acid,2-methyl-, 4-(1,1-dimethylethyl)cyclohexyl ester structure
|
Common Name | Propanoic acid,2-methyl-, 4-(1,1-dimethylethyl)cyclohexyl ester | ||
|---|---|---|---|---|
| CAS Number | 5451-57-0 | Molecular Weight | 226.35500 | |
| Density | 0.91g/cm3 | Boiling Point | 246.9ºC at 760 mmHg | |
| Molecular Formula | C14H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.5ºC | |
| Name | (4-tert-butylcyclohexyl) 2-methylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.91g/cm3 |
|---|---|
| Boiling Point | 246.9ºC at 760 mmHg |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.35500 |
| Flash Point | 109.5ºC |
| Exact Mass | 226.19300 |
| PSA | 26.30000 |
| LogP | 3.79050 |
| Index of Refraction | 1.453 |
| InChIKey | RMCOAKZBTKDTCI-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)OC1CCC(C(C)(C)C)CC1 |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 4-tert-butylcyclohexyl 2-methylpropanoate |
| p-tert-Butyl-cyclohexylisobutyrat |
| 4-tert-Butylcyclohexyl isobutyrate |