1-ethyl-5,5-diphenylimidazolidine-2,4-dione
Modify Date: 2025-08-23 19:21:15
1-ethyl-5,5-diphenylimidazolidine-2,4-dione structure
|
Common Name | 1-ethyl-5,5-diphenylimidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 54508-20-2 | Molecular Weight | 280.32100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-ethyl-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H16N2O2 |
|---|---|
| Molecular Weight | 280.32100 |
| Exact Mass | 280.12100 |
| PSA | 52.90000 |
| LogP | 2.71570 |
| InChIKey | HXSVCSTXGDMUJV-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)NC(=O)C1(c1ccccc1)c1ccccc1 |
|
~%
1-ethyl-5,5-dip... CAS#:54508-20-2 |
| Literature: Long et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 900,901 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,4-Imidazolidinedione,1-ethyl-5,5-diphenyl |
| 1-ethyl-5,5-diphenyl-imidazolidine-2,4-dione |
| 1-Aethyl-5,5-diphenyl-imidazolidin-2,4-dion |
| 1-Ethyl-5,5-diphenyl-hydantoin |