Androst-5-en-17-one, 3- (acetyloxy)-, cyclic 17-(1,2-ethanediyl monothioacetal), (3.beta.)-
Modify Date: 2025-08-24 20:55:37
Androst-5-en-17-one, 3- (acetyloxy)-, cyclic 17-(1,2-ethanediyl monothioacetal), (3.beta.)- structure
|
Common Name | Androst-5-en-17-one, 3- (acetyloxy)-, cyclic 17-(1,2-ethanediyl monothioacetal), (3.beta.)- | ||
|---|---|---|---|---|
| CAS Number | 54498-67-8 | Molecular Weight | 390.57900 | |
| Density | 1.17g/cm3 | Boiling Point | 501ºC at 760 mmHg | |
| Molecular Formula | C23H34O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.2ºC | |
| Name | (10,13-dimethylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-oxathiolane]-3-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 501ºC at 760 mmHg |
| Molecular Formula | C23H34O3S |
| Molecular Weight | 390.57900 |
| Flash Point | 239.2ºC |
| Exact Mass | 390.22300 |
| PSA | 60.83000 |
| LogP | 5.34060 |
| Index of Refraction | 1.574 |
| InChIKey | PVMWNUGBQSMJMG-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C3CCC23OCCS3)C1 |
|
~%
Androst-5-en-17... CAS#:54498-67-8 |
| Literature: Djerassi; Gorman Journal of the American Chemical Society, 1953 , vol. 75, p. 3704,3705, 3707 |
|
~%
Androst-5-en-17... CAS#:54498-67-8 |
| Literature: Djerassi; Gorman Journal of the American Chemical Society, 1953 , vol. 75, p. 3704,3705, 3707 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 10,13-dimethyl-1,2,3,4,7,8,9,10,11,12,13,14,15,16-tetradecahydrospiro[cyclopenta[a]phenanthrene-17,2'-[1,3]oxathiolan]-3-yl acetate |