3-(1-cyclohexenyl)-3-hydroxy-2-phenyl-butanoic acid
Modify Date: 2025-09-18 11:06:24
3-(1-cyclohexenyl)-3-hydroxy-2-phenyl-butanoic acid structure
|
Common Name | 3-(1-cyclohexenyl)-3-hydroxy-2-phenyl-butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 5449-98-9 | Molecular Weight | 260.32800 | |
| Density | 1.196g/cm3 | Boiling Point | 426.1ºC at 760 mmHg | |
| Molecular Formula | C16H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.7ºC | |
| Name | 3-(cyclohexen-1-yl)-3-hydroxy-2-phenylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 426.1ºC at 760 mmHg |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.32800 |
| Flash Point | 225.7ºC |
| Exact Mass | 260.14100 |
| PSA | 57.53000 |
| LogP | 3.10620 |
| Index of Refraction | 1.586 |
| InChIKey | GNCCBBXFPCKCJY-UHFFFAOYSA-N |
| SMILES | CC(O)(C1=CCCCC1)C(C(=O)O)c1ccccc1 |
| HS Code | 2918199090 |
|---|
|
~%
3-(1-cyclohexen... CAS#:5449-98-9 |
| Literature: Blicke; Zinnes Journal of the American Chemical Society, 1955 , vol. 77, p. 6247 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:7468-15-7| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-cyclohex-1-enyl-3-hydroxy-2-phenyl-butyric acid |
| 3-Cyclohex-1-enyl-3-hydroxy-2-phenyl-buttersaeure |