N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-ethoxy-benzamide structure
|
Common Name | N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-ethoxy-benzamide | ||
|---|---|---|---|---|
| CAS Number | 5448-80-6 | Molecular Weight | 339.36700 | |
| Density | 1.44g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H17N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-[[1-(2-oxooxolan-3-yl)ethylideneamino]sulfamoyl]phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.36700 |
| Exact Mass | 339.08900 |
| PSA | 122.31000 |
| LogP | 2.40700 |
| Index of Refraction | 1.63 |
| InChIKey | YHOQIKKFTVFVOM-CXUHLZMHSA-N |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NN=C(C)C2CCOC2=O)cc1 |
|
~%
N-[5-[(2,4-dich... CAS#:5448-80-6 |
| Literature: Zimmer et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 1667,1668, 1673 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Monoazo |
| Acid Golden G |
| metanil yellow |
| Metanilgelb extra |
| Kiton Yellow MS |
| Metanil Yellow C |
| Amacid Yellow M |
| Metanil Yellow E |
| ACID YELLOW 36 |
| Victoriagelb O |
| Fenazo Yellow M |
| Acid Metanil Yellow |