N-[4-[(propylideneamino)sulfamoyl]phenyl]acetamide structure
|
Common Name | N-[4-[(propylideneamino)sulfamoyl]phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 5448-64-6 | Molecular Weight | 269.32000 | |
| Density | 1.27g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H15N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-[[(Z)-propylideneamino]sulfamoyl]phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.32000 |
| Exact Mass | 269.08300 |
| PSA | 96.01000 |
| LogP | 2.86380 |
| Index of Refraction | 1.577 |
| InChIKey | DRORFIUUENOWQP-UHFFFAOYSA-N |
| SMILES | CCC=NNS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| HS Code | 2928000090 |
|---|
|
~%
N-[4-[(propylid... CAS#:5448-64-6 |
| Literature: Zimmer et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 1667,1668, 1673 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N-acetyl-sulfanilic acid propylidenehydrazide |
| N-Acetyl-sulfanilsaeure-propylidenhydrazid |