Benzamide,3-methyl-N,N-bis(1-methylethyl)- structure
|
Common Name | Benzamide,3-methyl-N,N-bis(1-methylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 5448-36-2 | Molecular Weight | 219.32300 | |
| Density | 0.962g/cm3 | Boiling Point | 338.1ºC at 760mmHg | |
| Molecular Formula | C14H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.2ºC | |
| Name | 3-methyl-N,N-di(propan-2-yl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.962g/cm3 |
|---|---|
| Boiling Point | 338.1ºC at 760mmHg |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.32300 |
| Flash Point | 146.2ºC |
| Exact Mass | 219.16200 |
| PSA | 20.31000 |
| LogP | 3.25400 |
| Index of Refraction | 1.508 |
| InChIKey | WPFBQNDWEOVSGC-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(=O)N(C(C)C)C(C)C)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-methyl-N,N-diisopropylbenzamide |
| N,N-DIISOPROPYL-3-TOLUAMIDE |
| N,N-Diisopropyl-m-toluamid |
| N,N-diisopropyl-3-methylbenzamide |