m-Toluamide, N,N-dipropyl-
Modify Date: 2024-01-23 16:51:28
m-Toluamide, N,N-dipropyl- structure
|
Common Name | m-Toluamide, N,N-dipropyl- | ||
|---|---|---|---|---|
| CAS Number | 5448-35-1 | Molecular Weight | 219.32300 | |
| Density | 0.966g/cm3 | Boiling Point | 349.6ºC at 760 mmHg | |
| Molecular Formula | C14H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.5ºC | |
| Name | 3-methyl-N,N-dipropylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.966g/cm3 |
|---|---|
| Boiling Point | 349.6ºC at 760 mmHg |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.32300 |
| Flash Point | 153.5ºC |
| Exact Mass | 219.16200 |
| PSA | 20.31000 |
| LogP | 3.25720 |
| Index of Refraction | 1.51 |
| InChIKey | RORAIVXVLZSPDZ-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C(=O)c1cccc(C)c1 |
| HS Code | 2924299090 |
|---|
|
~86%
m-Toluamide, N,... CAS#:5448-35-1 |
| Literature: Bhattacharya, Apurba; Plata, Robert Erik; Villarreal, Victor; Muramulla, Savitha; Wu, Jiejun Tetrahedron Letters, 2006 , vol. 47, # 4 p. 505 - 506 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| m-Toluamide,N,N-dipropyl |
| N,N-Dipropyl-m-toluamide |