ethyl 2,5-diiodo-4-methyl-1H-pyrrole-3-carboxylate
Modify Date: 2025-09-16 12:36:58
ethyl 2,5-diiodo-4-methyl-1H-pyrrole-3-carboxylate structure
|
Common Name | ethyl 2,5-diiodo-4-methyl-1H-pyrrole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5448-13-5 | Molecular Weight | 404.97100 | |
| Density | 2.218g/cm3 | Boiling Point | 444.3ºC at 760 mmHg | |
| Molecular Formula | C8H9I2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.5ºC | |
| Name | ethyl 2,5-diiodo-4-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.218g/cm3 |
|---|---|
| Boiling Point | 444.3ºC at 760 mmHg |
| Molecular Formula | C8H9I2NO2 |
| Molecular Weight | 404.97100 |
| Flash Point | 222.5ºC |
| Exact Mass | 404.87200 |
| PSA | 42.09000 |
| LogP | 2.70900 |
| Index of Refraction | 1.664 |
| InChIKey | WBTKKELHKSKSRS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(I)[nH]c(I)c1C |
| HS Code | 2933990090 |
|---|
|
~%
ethyl 2,5-diiod... CAS#:5448-13-5 |
| Literature: Kleinspehn; Corwin Journal of the American Chemical Society, 1953 , vol. 75, p. 5295,5297 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:2199-49-7| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5-Dijod-4-methyl-pyrrol-3-carbonsaeure-aethylester |
| 2,5-diiodo-4-methyl-pyrrole-3-carboxylic acid ethyl ester |