6-(4-chlorophenoxy)-7-methyl-purine structure
|
Common Name | 6-(4-chlorophenoxy)-7-methyl-purine | ||
|---|---|---|---|---|
| CAS Number | 5444-56-4 | Molecular Weight | 260.67900 | |
| Density | 1.44g/cm3 | Boiling Point | 429.6ºC at 760 mmHg | |
| Molecular Formula | C12H9ClN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.6ºC | |
| Name | 6-(4-chlorophenylthio)-3-aminopyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 429.6ºC at 760 mmHg |
| Molecular Formula | C12H9ClN4O |
| Molecular Weight | 260.67900 |
| Flash Point | 213.6ºC |
| Exact Mass | 260.04600 |
| PSA | 52.83000 |
| LogP | 2.80900 |
| Index of Refraction | 1.693 |
| InChIKey | VZXDOOONECWYRU-UHFFFAOYSA-N |
| SMILES | Cn1cnc2ncnc(Oc3ccc(Cl)cc3)c21 |
| HS Code | 2933990090 |
|---|
|
~%
6-(4-chlorophen... CAS#:5444-56-4 |
| Literature: Prasad; Robins Journal of the American Chemical Society, 1957 , vol. 79, p. 6401,6405 |
|
~%
6-(4-chlorophen... CAS#:5444-56-4 |
| Literature: Prasad; Robins Journal of the American Chemical Society, 1957 , vol. 79, p. 6401,6405 |
|
~%
6-(4-chlorophen... CAS#:5444-56-4 |
| Literature: Prasad; Robins Journal of the American Chemical Society, 1957 , vol. 79, p. 6401,6405 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-[(4-chlorophenyl)sulfanyl]-3-pyridinylamine |
| chlorophenylsulfanylpyridinylamine |
| 6-(4-Chlor-phenylmercapto)-[3]pyridylamin |
| 6-(4-chloro-phenoxy)-7-methyl-7H-purine |
| 6-(4-chloro-phenylsulfanyl)-[3]pyridylamine |
| 6-(4-Chlor-phenoxy)-7-methyl-7H-purin |
| 6-(4-chloro-phenylsulfanyl)-pyridin-3-ylamine |