2H-Purin-2-one,1,3,6,9-tetrahydro-9-phenyl-6-thioxo- structure
|
Common Name | 2H-Purin-2-one,1,3,6,9-tetrahydro-9-phenyl-6-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 5444-44-0 | Molecular Weight | 244.27200 | |
| Density | 1.57g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H8N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-phenyl-6-sulfanylidene-3H-purin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Molecular Formula | C11H8N4OS |
| Molecular Weight | 244.27200 |
| Exact Mass | 244.04200 |
| PSA | 98.56000 |
| LogP | 1.77140 |
| Index of Refraction | 1.809 |
| InChIKey | XNSVYORQDHFRNN-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=S)c2ncn(-c3ccccc3)c2[nH]1 |
| HS Code | 2933990090 |
|---|
|
~%
2H-Purin-2-one,... CAS#:5444-44-0 |
| Literature: Koppel; Robins Journal of the American Chemical Society, 1958 , vol. 80, p. 2751,2753 |
|
~%
2H-Purin-2-one,... CAS#:5444-44-0 |
| Literature: Koppel; Robins Journal of the American Chemical Society, 1958 , vol. 80, p. 2751,2753 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-phenyl-6-thioxo-1,3,6,9-tetrahydro-purin-2-one |
| HMS2780O18 |