methyl 3-(diethylaminomethyl)benzoate
Modify Date: 2024-04-11 15:28:12
methyl 3-(diethylaminomethyl)benzoate structure
|
Common Name | methyl 3-(diethylaminomethyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 5444-12-2 | Molecular Weight | 257.75600 | |
| Density | 1.02g/cm3 | Boiling Point | 295.2ºC at 760mmHg | |
| Molecular Formula | C13H20ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.6ºC | |
| Name | methyl 3-(diethylaminomethyl)benzoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 295.2ºC at 760mmHg |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.75600 |
| Flash Point | 101.6ºC |
| Exact Mass | 257.11800 |
| PSA | 29.54000 |
| LogP | 3.11700 |
| InChIKey | NWIWBYIKTXJRNM-UHFFFAOYSA-N |
| SMILES | CCN(CC)Cc1cccc(C(=O)OC)c1.Cl |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| methyl 3-(diethylaminomethyl)benzoate hydrochloride |