1-Propanone,3-(2-nitrophenyl)-1-phenyl-2,3-di-1-piperidinyl- structure
|
Common Name | 1-Propanone,3-(2-nitrophenyl)-1-phenyl-2,3-di-1-piperidinyl- | ||
|---|---|---|---|---|
| CAS Number | 5443-69-6 | Molecular Weight | 421.53200 | |
| Density | 1.196g/cm3 | Boiling Point | 578.9ºC at 760mmHg | |
| Molecular Formula | C25H31N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.9ºC | |
| Name | 3-(2-nitrophenyl)-1-phenyl-2,3-di(piperidin-1-yl)propan-1-one |
|---|
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 578.9ºC at 760mmHg |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.53200 |
| Flash Point | 303.9ºC |
| Exact Mass | 421.23700 |
| PSA | 69.37000 |
| LogP | 5.25820 |
| Index of Refraction | 1.603 |
| InChIKey | KCEDGJCNSXBJOR-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(C(c1ccccc1[N+](=O)[O-])N1CCCCC1)N1CCCCC1 |
| HS Code | 2933399090 |
|---|
|
~%
1-Propanone,3-(... CAS#:5443-69-6 |
| Literature: Cromwell; Mercer Journal of the American Chemical Society, 1957 , vol. 79, p. 3815,3818 |
|
~%
1-Propanone,3-(... CAS#:5443-69-6 |
| Literature: Cromwell; Mercer Journal of the American Chemical Society, 1957 , vol. 79, p. 3815,3818 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |