2-(propan-2-yl)-3a,4,7,7a-tetrahydro-1h-4,7-methanoisoindole-1,3(2h)-dione structure
|
Common Name | 2-(propan-2-yl)-3a,4,7,7a-tetrahydro-1h-4,7-methanoisoindole-1,3(2h)-dione | ||
|---|---|---|---|---|
| CAS Number | 5443-38-9 | Molecular Weight | 205.25300 | |
| Density | 1.215g/cm3 | Boiling Point | 340ºC at 760 mmHg | |
| Molecular Formula | C12H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.2ºC | |
| Name | 2-(propan-2-yl)-3a,4,7,7a-tetrahydro-1h-4,7-methanoisoindole-1,3(2h)-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.215g/cm3 |
|---|---|
| Boiling Point | 340ºC at 760 mmHg |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.25300 |
| Flash Point | 152.2ºC |
| Exact Mass | 205.11000 |
| PSA | 37.38000 |
| LogP | 1.13980 |
| Index of Refraction | 1.563 |
| InChIKey | CCGKCUKWRHWJSR-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)C2C3C=CC(C3)C2C1=O |
|
~%
2-(propan-2-yl)... CAS#:5443-38-9 |
| Literature: Newman; Magerlein; Wheatley Journal of the American Chemical Society, 1946 , vol. 68, p. 2112,2114 |
|
~%
2-(propan-2-yl)... CAS#:5443-38-9 |
| Literature: Tarabara; Kas'yan; Yarovoi; Shishkina; Shishkin Russian Journal of Organic Chemistry, 2004 , vol. 40, # 7 p. 992 - 998 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Isopropyl-(3ac,7ac)-3a,4,7,7a-tetrahydro-4r,7c-methano-isoindol-1,3-dion |
| N-isopropylbicyclo[2.2.1]hept-5-ene-endo-2,endo-3-dicarboximide |
| 2-isopropyl-(3ac,7ac)-3a,4,7,7a-tetrahydro-4r,7c-methano-isoindole-1,3-dione |