Ethanethione,1-(4-morpholinyl)-2-(2-phenyl-4-quinolinyl)-
Modify Date: 2025-09-10 18:13:57
Ethanethione,1-(4-morpholinyl)-2-(2-phenyl-4-quinolinyl)- structure
|
Common Name | Ethanethione,1-(4-morpholinyl)-2-(2-phenyl-4-quinolinyl)- | ||
|---|---|---|---|---|
| CAS Number | 5442-77-3 | Molecular Weight | 348.46100 | |
| Density | 1.24g/cm3 | Boiling Point | 541ºC at 760mmHg | |
| Molecular Formula | C21H20N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281ºC | |
| Name | 1-morpholin-4-yl-2-(2-phenylquinolin-4-yl)ethanethione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 541ºC at 760mmHg |
| Molecular Formula | C21H20N2OS |
| Molecular Weight | 348.46100 |
| Flash Point | 281ºC |
| Exact Mass | 348.13000 |
| PSA | 57.45000 |
| LogP | 4.04180 |
| Index of Refraction | 1.671 |
| InChIKey | VKXZKCYVYFWINA-UHFFFAOYSA-N |
| SMILES | S=C(Cc1cc(-c2ccccc2)nc2ccccc12)N1CCOCC1 |
| HS Code | 2934999090 |
|---|
|
~%
Ethanethione,1-... CAS#:5442-77-3 |
| Literature: Schwenk; Papa Journal of Organic Chemistry, 1946 , vol. 11, p. 798,800 |
|
~%
Ethanethione,1-... CAS#:5442-77-3 |
| Literature: Schwenk; Papa Journal of Organic Chemistry, 1946 , vol. 11, p. 798,800 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-[(2-Phenyl-[4]chinolyl)-thioacetyl]-morpholin |
| 1-(morpholin-4-yl)-2-(2-phenylquinolin-4-yl)ethanethione |
| 4-[(2-phenyl-[4]quinolyl)-thioacetyl]-morpholine |