2-(dibutylamino)-1-(2,4-dichloro-3-methyl-phenyl)ethanol structure
|
Common Name | 2-(dibutylamino)-1-(2,4-dichloro-3-methyl-phenyl)ethanol | ||
|---|---|---|---|---|
| CAS Number | 5442-66-0 | Molecular Weight | 332.30800 | |
| Density | 1.107g/cm3 | Boiling Point | 432.2ºC at 760 mmHg | |
| Molecular Formula | C17H27Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.2ºC | |
| Name | 2-(dibutylamino)-1-(2,4-dichloro-3-methylphenyl)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 432.2ºC at 760 mmHg |
| Molecular Formula | C17H27Cl2NO |
| Molecular Weight | 332.30800 |
| Flash Point | 215.2ºC |
| Exact Mass | 331.14700 |
| PSA | 23.47000 |
| LogP | 5.23740 |
| Index of Refraction | 1.53 |
| InChIKey | SGEGJUUAHSLYGV-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)CC(O)c1ccc(Cl)c(C)c1Cl |
|
~%
2-(dibutylamino... CAS#:5442-66-0 |
| Literature: Lutz et al. Journal of Organic Chemistry, 1947 , vol. 12, p. 617,680 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Dibutylamino-1-(2,4-dichlor-3-methyl-phenyl)-aethanol |
| 2-dibutylamino-1-(2,4-dichloro-3-methyl-phenyl)-ethanol |