1H-Pyrazolo[3,4-d]pyrimidin-4-amine,N-[(4-chlorophenyl)methyl]-1-methyl- structure
|
Common Name | 1H-Pyrazolo[3,4-d]pyrimidin-4-amine,N-[(4-chlorophenyl)methyl]-1-methyl- | ||
|---|---|---|---|---|
| CAS Number | 5441-46-3 | Molecular Weight | 273.72100 | |
| Density | 1.4g/cm3 | Boiling Point | 458.4ºC at 760mmHg | |
| Molecular Formula | C13H12ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231ºC | |
| Name | N-[(4-chlorophenyl)methyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 458.4ºC at 760mmHg |
| Molecular Formula | C13H12ClN5 |
| Molecular Weight | 273.72100 |
| Flash Point | 231ºC |
| Exact Mass | 273.07800 |
| PSA | 55.63000 |
| LogP | 2.70180 |
| Index of Refraction | 1.702 |
| InChIKey | JMHQWHUUDRUTPU-UHFFFAOYSA-N |
| SMILES | Cn1ncc2c(NCc3ccc(Cl)cc3)ncnc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |