4-Amino-3-nitrophenylpropionic acid
Modify Date: 2025-08-24 22:16:15
4-Amino-3-nitrophenylpropionic acid structure
|
Common Name | 4-Amino-3-nitrophenylpropionic acid | ||
|---|---|---|---|---|
| CAS Number | 54405-44-6 | Molecular Weight | 210.18700 | |
| Density | 1.424 g/cm3 | Boiling Point | 449.4ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.6ºC | |
| Name | 3-(4-amino-3-nitrophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.424 g/cm3 |
|---|---|
| Boiling Point | 449.4ºC at 760 mmHg |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.18700 |
| Flash Point | 225.6ºC |
| Exact Mass | 210.06400 |
| PSA | 109.14000 |
| LogP | 2.29860 |
| InChIKey | SJVISUXJSCQKSC-UHFFFAOYSA-N |
| SMILES | Nc1ccc(CCC(=O)O)cc1[N+](=O)[O-] |
| HS Code | 2922499990 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:1664-54-6
CAS#:1664-57-9| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| benzenepropanoic acid,4-amino-3-nitro |
| 3-Nitro-4-amino-hydrozimtsaeure |