Sercloremine
Modify Date: 2025-11-08 19:48:08
Sercloremine structure
|
Common Name | Sercloremine | ||
|---|---|---|---|---|
| CAS Number | 54403-19-9 | Molecular Weight | 249.73600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SercloremineA selective, reversible inhibitor of MAO-A and serotonin reuptake inhibitor as an antidepressant.. |
| Name | 4-(5-chloro-1-benzofuran-2-yl)-1-methylpiperidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16ClNO |
|---|---|
| Molecular Weight | 249.73600 |
| Exact Mass | 249.09200 |
| PSA | 16.38000 |
| LogP | 3.83330 |
| InChIKey | FTKTZRKAVSDSRA-UHFFFAOYSA-N |
| SMILES | CN1CCC(c2cc3cc(Cl)ccc3o2)CC1 |
| HS Code | 2934999090 |
|---|
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Sercloremine |
| 1-Methyl-4-(5-chlor-2-benzofuranyl)-piperidin |
| 4-(5-Chloro-2-benzofuranyl)-1-methyl-piperidine |
| 4-(5-chloro-benzofuran-2-yl)-1-methyl-piperidine |
| UNII-8H340QZ35T |